C19H23F2IN6O — CID 111015600
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015600) has the molecular formula C19H23F2IN6O and a molecular weight of 516.33 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015600 |
| Molecular Formula | C19H23F2IN6O |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C19H22F2N6O.HI/c1-2-22-19(24-12-18-26-25-17-8-3-4-9-27(17)18)23-11-14-6-5-7-15(10-14)28-13-16(20)21;/h3-10,16H,2,11-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | IAQSBNFYMFCCRM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|