C18H25F2IN4O2 — CID 109431976
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109431976) has the molecular formula C18H25F2IN4O2 and a molecular weight of 494.32 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109431976 |
| Molecular Formula | C18H25F2IN4O2 |
| Molecular Weight | 494.32 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C18H24F2N4O2.HI/c1-4-21-18(23-10-17-24-12(2)13(3)26-17)22-9-14-6-5-7-15(8-14)25-11-16(19)20;/h5-8,16H,4,9-11H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | RKJBWPFNWNFRLW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|