C18H23F3N4O2 — CID 109431131
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 109431131) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109431131 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)(F)F)c1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C18H23F3N4O2/c1-4-22-17(24-10-16-25-12(2)13(3)27-16)23-9-14-6-5-7-15(8-14)26-11-18(19,20)21/h5-8H,4,9-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | IBKFANSHAMFWKW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|