C17H23FN4O — CID 111846753
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]guanidine (PubChem CID 111846753) has the molecular formula C17H23FN4O and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111846753 |
| Molecular Formula | C17H23FN4O |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C17H23FN4O/c1-5-19-17(21-10-16-22-12(3)13(4)23-16)20-9-14-7-6-11(2)15(18)8-14/h6-8H,5,9-10H2,1-4H3,(H2,19,20,21) |
| InChIKey | SJTBZFKCUMSUPD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|