C18H28IN5O3S — CID 109428682
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109428682) has the molecular formula C18H28IN5O3S and a molecular weight of 521.43 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109428682 |
| Molecular Formula | C18H28IN5O3S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C18H27N5O3S.HI/c1-5-20-18(22-11-17-23-13(2)14(3)26-17)21-10-15-6-8-16(9-7-15)12-27(24,25)19-4;/h6-9,19H,5,10-12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | UGLNQUDQCCAOKR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|