C21H32IN5O3S — CID 109431990
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 109431990) has the molecular formula C21H32IN5O3S and a molecular weight of 561.49 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109431990 |
| Molecular Formula | C21H32IN5O3S |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C21H31N5O3S.HI/c1-4-22-21(24-15-20-25-16(2)17(3)29-20)23-14-18-8-10-19(11-9-18)30(27,28)26-12-6-5-7-13-26;/h8-11H,4-7,12-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | FEQHCLBRGUKLIU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|