C20H32IN5O3S — CID 109430990
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109430990) has the molecular formula C20H32IN5O3S and a molecular weight of 549.48 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109430990 |
| Molecular Formula | C20H32IN5O3S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CS(=O)(=O)NC(C)C)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C20H31N5O3S.HI/c1-6-21-20(23-12-19-24-15(4)16(5)28-19)22-11-17-9-7-8-10-18(17)13-29(26,27)25-14(2)3;/h7-10,14,25H,6,11-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | GRCYPTFWNQFLAG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|