C17H23F3IN5O2 — CID 109432514
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 109432514) has the molecular formula C17H23F3IN5O2 and a molecular weight of 513.30 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109432514 |
| Molecular Formula | C17H23F3IN5O2 |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC(F)(F)F)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C17H22F3N5O2.HI/c1-4-21-16(24-9-14-25-11(2)12(3)27-14)23-8-13-6-5-7-22-15(13)26-10-17(18,19)20;/h5-7H,4,8-10H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | BSYQLFYOIPJDHR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|