C17H26IN5O2 — CID 109430278
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109430278) has the molecular formula C17H26IN5O2 and a molecular weight of 459.33 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109430278 |
| Molecular Formula | C17H26IN5O2 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCCOc1ncccc1CN/C(=N/C)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C17H25N5O2.HI/c1-5-9-23-16-14(7-6-8-19-16)10-20-17(18-4)21-11-15-22-12(2)13(3)24-15;/h6-8H,5,9-11H2,1-4H3,(H2,18,20,21);1H |
| InChIKey | KOIGOYWNWHSBBU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|