C14H22F3IN4O — CID 109472870
2-methyl-1-[(2-propoxy-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472870) has the molecular formula C14H22F3IN4O and a molecular weight of 446.26 g/mol. Its IUPAC name is 2-methyl-1-[(2-propoxy-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-propoxy-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472870 |
| Molecular Formula | C14H22F3IN4O |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-methyl-1-[(2-propoxy-3-pyridinyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCCOc1ncccc1CN/C(=N/C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H21F3N4O.HI/c1-3-9-22-12-11(5-4-7-19-12)10-21-13(18-2)20-8-6-14(15,16)17;/h4-5,7H,3,6,8-10H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | SGQYCZGPAGGGHV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|