C20H26F3IN4O3 — CID 111879220
1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111879220) has the molecular formula C20H26F3IN4O3 and a molecular weight of 554.35 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111879220 |
| Molecular Formula | C20H26F3IN4O3 |
| Molecular Weight | 554.35 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC(F)(F)F)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C20H25F3N4O3.HI/c1-4-24-19(26-11-14-7-8-16(28-2)10-17(14)29-3)27-12-15-6-5-9-25-18(15)30-13-20(21,22)23;/h5-10H,4,11-13H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | AVPFJKJYSGMSHJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|