C18H29F3N4O2 — CID 111239339
1-(3-butoxypropyl)-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111239339) has the molecular formula C18H29F3N4O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-butoxypropyl)-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111239339 |
| Molecular Formula | C18H29F3N4O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-(3-butoxypropyl)-3-ethyl-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCCCOCCCN/C(=N/Cc1cccnc1OCC(F)(F)F)NCC |
| InChI | InChI=1S/C18H29F3N4O2/c1-3-5-11-26-12-7-10-24-17(22-4-2)25-13-15-8-6-9-23-16(15)27-14-18(19,20)21/h6,8-9H,3-5,7,10-14H2,1-2H3,(H2,22,24,25) |
| InChIKey | IIZSYDQRXYZNTJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|