C17H24F6IN3O2 — CID 111870920
1-ethyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111870920) has the molecular formula C17H24F6IN3O2 and a molecular weight of 543.29 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111870920 |
| Molecular Formula | C17H24F6IN3O2 |
| Molecular Weight | 543.29 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 1-ethyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C17H23F6N3O2.HI/c1-2-24-15(25-8-3-9-27-11-16(18,19)20)26-10-13-4-6-14(7-5-13)28-12-17(21,22)23;/h4-7H,2-3,8-12H2,1H3,(H2,24,25,26);1H |
| InChIKey | FNQAGIWODTXUCA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|