C16H21F6N3O — CID 111420597
1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111420597) has the molecular formula C16H21F6N3O and a molecular weight of 385.35 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111420597 |
| Molecular Formula | C16H21F6N3O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C16H21F6N3O/c1-2-23-14(24-8-3-9-26-11-15(17,18)19)25-10-12-4-6-13(7-5-12)16(20,21)22/h4-7H,2-3,8-11H2,1H3,(H2,23,24,25) |
| InChIKey | DNLBUACIQUVXOS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|