C13H21F3IN3OS — CID 111258524
1-ethyl-2-(thiophen-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111258524) has the molecular formula C13H21F3IN3OS and a molecular weight of 451.30 g/mol. Its IUPAC name is 1-ethyl-2-(thiophen-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(thiophen-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258524 |
| Molecular Formula | C13H21F3IN3OS |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-ethyl-2-(thiophen-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C13H20F3N3OS.HI/c1-2-17-12(19-9-11-5-3-8-21-11)18-6-4-7-20-10-13(14,15)16;/h3,5,8H,2,4,6-7,9-10H2,1H3,(H2,17,18,19);1H |
| InChIKey | MQUYHZXDNDUCMZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|