C16H26F3N3OS — CID 111674188
1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111674188) has the molecular formula C16H26F3N3OS and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111674188 |
| Molecular Formula | C16H26F3N3OS |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C16H26F3N3OS/c1-3-20-15(21-7-5-8-23-12-16(17,18)19)22-11-13(2)10-14-6-4-9-24-14/h4,6,9,13H,3,5,7-8,10-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | SKVCUZVDLIFTJY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|