C19H28N4OS2 — CID 111673216
N-[3-[[N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111673216) has the molecular formula C19H28N4OS2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111673216 |
| Molecular Formula | C19H28N4OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[3-[[N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H28N4OS2/c1-3-20-19(23-14-15(2)13-16-7-4-11-25-16)22-10-6-9-21-18(24)17-8-5-12-26-17/h4-5,7-8,11-12,15H,3,6,9-10,13-14H2,1-2H3,(H,21,24)(H2,20,22,23) |
| InChIKey | MBAJRGKWFFYELK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|