C17H33IN4O2S2 — CID 111987590
1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111987590) has the molecular formula C17H33IN4O2S2 and a molecular weight of 516.52 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987590 |
| Molecular Formula | C17H33IN4O2S2 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)NCCS(=O)(=O)N(CC)CC.I |
| InChI | InChI=1S/C17H32N4O2S2.HI/c1-5-18-17(19-10-12-25(22,23)21(6-2)7-3)20-14-15(4)13-16-9-8-11-24-16;/h8-9,11,15H,5-7,10,12-14H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | BEZKXBFSDDKGFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|