C19H35IN4O3S2 — CID 111673883
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111673883) has the molecular formula C19H35IN4O3S2 and a molecular weight of 558.55 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673883 |
| Molecular Formula | C19H35IN4O3S2 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)NCCS(=O)(=O)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C19H34N4O3S2.HI/c1-5-20-19(22-12-15(2)11-18-7-6-9-27-18)21-8-10-28(24,25)23-13-16(3)26-17(4)14-23;/h6-7,9,15-17H,5,8,10-14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | YNOAAAFCBOWPHA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|