C18H30FIN4O3S — CID 111876734
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111876734) has the molecular formula C18H30FIN4O3S and a molecular weight of 528.43 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111876734 |
| Molecular Formula | C18H30FIN4O3S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCS(=O)(=O)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C18H29FN4O3S.HI/c1-4-20-18(22-11-16-6-5-7-17(19)10-16)21-8-9-27(24,25)23-12-14(2)26-15(3)13-23;/h5-7,10,14-15H,4,8-9,11-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | NUTSOQBXRVRXPH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|