C20H25FN4O2S — CID 111876745
1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 111876745) has the molecular formula C20H25FN4O2S and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111876745 |
| Molecular Formula | C20H25FN4O2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCS(=O)(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H25FN4O2S/c1-2-22-20(24-15-16-6-5-8-18(21)14-16)23-11-13-28(26,27)25-12-10-17-7-3-4-9-19(17)25/h3-9,14H,2,10-13,15H2,1H3,(H2,22,23,24) |
| InChIKey | CNTKMDUPBIIVPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|