C22H31IN4O4S — CID 111201191
1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111201191) has the molecular formula C22H31IN4O4S and a molecular weight of 574.49 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111201191 |
| Molecular Formula | C22H31IN4O4S |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCCS(=O)(=O)N1CCc2ccccc21.I |
| InChI | InChI=1S/C22H30N4O4S.HI/c1-4-23-22(25-16-17-9-10-20(29-2)21(15-17)30-3)24-12-14-31(27,28)26-13-11-18-7-5-6-8-19(18)26;/h5-10,15H,4,11-14,16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | KBRISCZUEHECOK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|