C23H33FIN5O — CID 111395386
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111395386) has the molecular formula C23H33FIN5O and a molecular weight of 541.45 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111395386 |
| Molecular Formula | C23H33FIN5O |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CC(C)OC(C)C2)nc1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C23H32FN5O.HI/c1-4-25-23(26-11-10-19-6-5-7-21(24)12-19)28-14-20-8-9-22(27-13-20)29-15-17(2)30-18(3)16-29;/h5-9,12-13,17-18H,4,10-11,14-16H2,1-3H3,(H2,25,26,28);1H |
| InChIKey | SURSYJGHPBCTEK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|