C25H33FN4O2 — CID 111395195
2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine (PubChem CID 111395195) has the molecular formula C25H33FN4O2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine.
| Compound Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111395195 |
| Molecular Formula | C25H33FN4O2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CC(C)OC(C)C2)cc1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C25H33FN4O2/c1-4-27-25(28-13-12-20-6-5-7-23(26)14-20)29-15-21-8-10-22(11-9-21)24(31)30-16-18(2)32-19(3)17-30/h5-11,14,18-19H,4,12-13,15-17H2,1-3H3,(H2,27,28,29) |
| InChIKey | MELJUBNPTJBXJY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|