C24H39IN4O2 — CID 111255728
2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(4-methylcyclohexyl)guanidine;hydroiodide (PubChem CID 111255728) has the molecular formula C24H39IN4O2 and a molecular weight of 542.51 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(4-methylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111255728 |
| Molecular Formula | C24H39IN4O2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CC(C)OC(C)C2)cc1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C24H38N4O2.HI/c1-5-25-24(27-22-12-6-17(2)7-13-22)26-14-20-8-10-21(11-9-20)23(29)28-15-18(3)30-19(4)16-28;/h8-11,17-19,22H,5-7,12-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | FUEBSCBDESEPHE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|