C23H37IN4O2 — CID 111210198
N'-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111210198) has the molecular formula C23H37IN4O2 and a molecular weight of 528.48 g/mol. Its IUPAC name is N'-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111210198 |
| Molecular Formula | C23H37IN4O2 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | N'-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-N-ethyl-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CC(C)OC(C)C2)cc1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C23H36N4O2.HI/c1-5-24-23(26-12-10-17(2)11-13-26)25-14-20-6-8-21(9-7-20)22(28)27-15-18(3)29-19(4)16-27;/h6-9,17-19H,5,10-16H2,1-4H3,(H,24,25);1H |
| InChIKey | QFXPNNNVVDQUBE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|