C19H30N4O2 — CID 111083743
2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111083743) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111083743 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CC1CN(C(=O)c2ccc(CN=C(N(C)C)N(C)C)cc2)CC(C)O1 |
| InChI | InChI=1S/C19H30N4O2/c1-14-12-23(13-15(2)25-14)18(24)17-9-7-16(8-10-17)11-20-19(21(3)4)22(5)6/h7-10,14-15H,11-13H2,1-6H3 |
| InChIKey | ONMZHEXZPMYVPX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|