C15H18N2O2 — CID 82179212
2-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]acetonitrile (PubChem CID 82179212) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]acetonitrile.
| Compound Name | 2-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 82179212 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]acetonitrile |
| SMILES | CC1CN(C(=O)c2ccc(CC#N)cc2)CC(C)O1 |
| InChI | InChI=1S/C15H18N2O2/c1-11-9-17(10-12(2)19-11)15(18)14-5-3-13(4-6-14)7-8-16/h3-6,11-12H,7,9-10H2,1-2H3 |
| InChIKey | WPDVQPQKGZHUKI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |