C23H36N4O2S — CID 111529441
2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111529441) has the molecular formula C23H36N4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111529441 |
| Molecular Formula | C23H36N4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CC(C)OC(C)C2)cc1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C23H36N4O2S/c1-5-24-23(26-20-10-11-21(12-20)30-4)25-13-18-6-8-19(9-7-18)22(28)27-14-16(2)29-17(3)15-27/h6-9,16-17,20-21H,5,10-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | GLWUPZJIKFQOOZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|