C21H36IN5OS — CID 111529240
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111529240) has the molecular formula C21H36IN5OS and a molecular weight of 533.52 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111529240 |
| Molecular Formula | C21H36IN5OS |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CC(C)OC(C)C2)nc1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C21H35N5OS.HI/c1-5-22-21(25-18-7-8-19(10-18)28-4)24-12-17-6-9-20(23-11-17)26-13-15(2)27-16(3)14-26;/h6,9,11,15-16,18-19H,5,7-8,10,12-14H2,1-4H3,(H2,22,24,25);1H |
| InChIKey | PCSOIRXBDBJDDC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|