C16H35IN4O3S — CID 111129885
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-pentylguanidine;hydroiodide (PubChem CID 111129885) has the molecular formula C16H35IN4O3S and a molecular weight of 490.45 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-pentylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111129885 |
| Molecular Formula | C16H35IN4O3S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-ethyl-2-pentylguanidine;hydroiodide |
| SMILES | CCCCC/N=C(\NCC)NCCS(=O)(=O)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C16H34N4O3S.HI/c1-5-7-8-9-18-16(17-6-2)19-10-11-24(21,22)20-12-14(3)23-15(4)13-20;/h14-15H,5-13H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | XYBUAUKSOUWPHU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|