C13H29IN4O3S — CID 111227662
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-propylguanidine;hydroiodide (PubChem CID 111227662) has the molecular formula C13H29IN4O3S and a molecular weight of 448.37 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-propylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111227662 |
| Molecular Formula | C13H29IN4O3S |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NCCS(=O)(=O)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C13H28N4O3S.HI/c1-5-6-15-13(14-4)16-7-8-21(18,19)17-9-11(2)20-12(3)10-17;/h11-12H,5-10H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | YXXDPIDAPOTICM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|