C14H30N4O3S — CID 111181023
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-(2-methylpropyl)guanidine (PubChem CID 111181023) has the molecular formula C14H30N4O3S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-(2-methylpropyl)guanidine.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111181023 |
| Molecular Formula | C14H30N4O3S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-2-methyl-3-(2-methylpropyl)guanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CC(C)OC(C)C1)NCC(C)C |
| InChI | InChI=1S/C14H30N4O3S/c1-11(2)8-17-14(15-5)16-6-7-22(19,20)18-9-12(3)21-13(4)10-18/h11-13H,6-10H2,1-5H3,(H2,15,16,17) |
| InChIKey | VPWKUKPCCQQCPJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|