C14H32IN3O2S — CID 111573568
1-(2-tert-butylsulfonylethyl)-3-ethyl-2-pentylguanidine;hydroiodide (PubChem CID 111573568) has the molecular formula C14H32IN3O2S and a molecular weight of 433.40 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-pentylguanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573568 |
| Molecular Formula | C14H32IN3O2S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-pentylguanidine;hydroiodide |
| SMILES | CCCCC/N=C(\NCC)NCCS(=O)(=O)C(C)(C)C.I |
| InChI | InChI=1S/C14H31N3O2S.HI/c1-6-8-9-10-16-13(15-7-2)17-11-12-20(18,19)14(3,4)5;/h6-12H2,1-5H3,(H2,15,16,17);1H |
| InChIKey | SYJMYAPVTUIMGY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|