C17H39IN4O2S — CID 111573658
1-(2-tert-butylsulfonylethyl)-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111573658) has the molecular formula C17H39IN4O2S and a molecular weight of 490.50 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573658 |
| Molecular Formula | C17H39IN4O2S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C(C)C)C(C)C)NCCS(=O)(=O)C(C)(C)C.I |
| InChI | InChI=1S/C17H38N4O2S.HI/c1-9-18-16(19-10-12-21(14(2)3)15(4)5)20-11-13-24(22,23)17(6,7)8;/h14-15H,9-13H2,1-8H3,(H2,18,19,20);1H |
| InChIKey | ILOKSHNXRFAWHM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|