C17H39N5O2S — CID 111764143
1-[2-(diethylsulfamoyl)ethyl]-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine (PubChem CID 111764143) has the molecular formula C17H39N5O2S and a molecular weight of 377.60 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111764143 |
| Molecular Formula | C17H39N5O2S |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-2-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCN(C(C)C)C(C)C)NCCS(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C17H39N5O2S/c1-8-18-17(19-11-13-22(15(4)5)16(6)7)20-12-14-25(23,24)21(9-2)10-3/h15-16H,8-14H2,1-7H3,(H2,18,19,20) |
| InChIKey | LXMGNMHETHAJOS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|