C12H28N4O2S — CID 111763409
1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-propylguanidine (PubChem CID 111763409) has the molecular formula C12H28N4O2S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-propylguanidine.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-propylguanidine |
|---|---|
| PubChem CID | 111763409 |
| Molecular Formula | C12H28N4O2S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-3-ethyl-2-propylguanidine |
| SMILES | CCC/N=C(\NCC)NCCS(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C12H28N4O2S/c1-5-9-14-12(13-6-2)15-10-11-19(17,18)16(7-3)8-4/h5-11H2,1-4H3,(H2,13,14,15) |
| InChIKey | AAHDWOHGSIAAIE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|