C19H42IN5O2 — CID 111248908
tert-butyl N-[3-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111248908) has the molecular formula C19H42IN5O2 and a molecular weight of 499.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111248908 |
| Molecular Formula | C19H42IN5O2 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | tert-butyl N-[3-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C19H41N5O2.HI/c1-9-20-17(22-13-14-24(15(2)3)16(4)5)21-11-10-12-23-18(25)26-19(6,7)8;/h15-16H,9-14H2,1-8H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | RAGQYTZDDBRICI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|