C18H38IN5O3 — CID 111886232
tert-butyl N-[3-[[[2-(2,2-dimethylpropanoylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111886232) has the molecular formula C18H38IN5O3 and a molecular weight of 499.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[[2-(2,2-dimethylpropanoylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[[2-(2,2-dimethylpropanoylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886232 |
| Molecular Formula | C18H38IN5O3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | tert-butyl N-[3-[[[2-(2,2-dimethylpropanoylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCNC(=O)C(C)(C)C.I |
| InChI | InChI=1S/C18H37N5O3.HI/c1-8-19-15(22-13-12-20-14(24)17(2,3)4)21-10-9-11-23-16(25)26-18(5,6)7;/h8-13H2,1-7H3,(H,20,24)(H,23,25)(H2,19,21,22);1H |
| InChIKey | DSIZNXWFFJTEKX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|