C15H32N4O2 — CID 111150576
tert-butyl N-[3-[[butylamino(ethylamino)methylidene]amino]propyl]carbamate (PubChem CID 111150576) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[butylamino(ethylamino)methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[butylamino(ethylamino)methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111150576 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | tert-butyl N-[3-[[butylamino(ethylamino)methylidene]amino]propyl]carbamate |
| SMILES | CCCCN/C(=N/CCCNC(=O)OC(C)(C)C)NCC |
| InChI | InChI=1S/C15H32N4O2/c1-6-8-10-17-13(16-7-2)18-11-9-12-19-14(20)21-15(3,4)5/h6-12H2,1-5H3,(H,19,20)(H2,16,17,18) |
| InChIKey | JXIWNMWIVPFPEO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|