C15H33IN4O4S — CID 111887382
tert-butyl N-[3-[[ethylamino-(2-ethylsulfonylethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111887382) has the molecular formula C15H33IN4O4S and a molecular weight of 492.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-(2-ethylsulfonylethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[ethylamino-(2-ethylsulfonylethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887382 |
| Molecular Formula | C15H33IN4O4S |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-(2-ethylsulfonylethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C15H32N4O4S.HI/c1-6-16-13(18-11-12-24(21,22)7-2)17-9-8-10-19-14(20)23-15(3,4)5;/h6-12H2,1-5H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | CBSVRUCSARTJAY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|