C14H30IN5O3 — CID 111884006
tert-butyl N-[2-[[N'-(2-acetamidoethyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111884006) has the molecular formula C14H30IN5O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-(2-acetamidoethyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-(2-acetamidoethyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111884006 |
| Molecular Formula | C14H30IN5O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | tert-butyl N-[2-[[N'-(2-acetamidoethyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCNC(C)=O)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C14H29N5O3.HI/c1-6-15-12(17-8-7-16-11(2)20)18-9-10-19-13(21)22-14(3,4)5;/h6-10H2,1-5H3,(H,16,20)(H,19,21)(H2,15,17,18);1H |
| InChIKey | BYLISQRRJHZISG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|