C16H34N4O2 — CID 111891859
tert-butyl N-[2-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111891859) has the molecular formula C16H34N4O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111891859 |
| Molecular Formula | C16H34N4O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(CC)CC)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34N4O2/c1-7-13(8-2)12-20-14(17-9-3)18-10-11-19-15(21)22-16(4,5)6/h13H,7-12H2,1-6H3,(H,19,21)(H2,17,18,20) |
| InChIKey | CKWCPKXYJNOPAN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|