C18H37N5O2 — CID 111884343
tert-butyl N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111884343) has the molecular formula C18H37N5O2 and a molecular weight of 355.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884343 |
| Molecular Formula | C18H37N5O2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-ylbutyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(CC)N1CCCC1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37N5O2/c1-6-15(23-12-8-9-13-23)14-22-16(19-7-2)20-10-11-21-17(24)25-18(3,4)5/h15H,6-14H2,1-5H3,(H,21,24)(H2,19,20,22) |
| InChIKey | LAIRJYQGJFSYEA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|