C18H35N5O3 — CID 111366229
tert-butyl N-[3-[[ethylamino-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]methylidene]amino]propyl]carbamate (PubChem CID 111366229) has the molecular formula C18H35N5O3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111366229 |
| Molecular Formula | C18H35N5O3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H35N5O3/c1-5-19-16(21-12-9-15(24)23-13-6-7-14-23)20-10-8-11-22-17(25)26-18(2,3)4/h5-14H2,1-4H3,(H,22,25)(H2,19,20,21) |
| InChIKey | ZSPMACUJFANWMB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|