C15H32N4O2S — CID 111626194
tert-butyl N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111626194) has the molecular formula C15H32N4O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111626194 |
| Molecular Formula | C15H32N4O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCCCSC)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N4O2S/c1-6-16-13(17-9-7-8-12-22-5)18-10-11-19-14(20)21-15(2,3)4/h6-12H2,1-5H3,(H,19,20)(H2,16,17,18) |
| InChIKey | WJUOGWWOXFNFKB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|