C15H30N4O2S — CID 111885139
tert-butyl N-[2-[[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885139) has the molecular formula C15H30N4O2S and a molecular weight of 330.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885139 |
| Molecular Formula | C15H30N4O2S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | C=CCSCC/N=C(\NCC)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N4O2S/c1-6-11-22-12-10-18-13(16-7-2)17-8-9-19-14(20)21-15(3,4)5/h6H,1,7-12H2,2-5H3,(H,19,20)(H2,16,17,18) |
| InChIKey | SEXIYBCDWMYWHN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|