C15H32N4OS — CID 111626478
N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111626478) has the molecular formula C15H32N4OS and a molecular weight of 316.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111626478 |
| Molecular Formula | C15H32N4OS |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCCCSC)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H32N4OS/c1-6-16-14(18-9-7-8-12-21-5)19-11-10-17-13(20)15(2,3)4/h6-12H2,1-5H3,(H,17,20)(H2,16,18,19) |
| InChIKey | AHKSKMLORHYLOV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|