C18H27F3N4OS — CID 111626432
N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 111626432) has the molecular formula C18H27F3N4OS and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 111626432 |
| Molecular Formula | C18H27F3N4OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN/C(=N\CCCCSC)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H27F3N4OS/c1-3-22-17(24-10-4-5-13-27-2)25-12-11-23-16(26)14-6-8-15(9-7-14)18(19,20)21/h6-9H,3-5,10-13H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | BUEAFYGDQIHZOP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|