C18H25F3IN3S — CID 136926456
1-ethyl-2-(4-methylsulfanylbutyl)-3-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 136926456) has the molecular formula C18H25F3IN3S and a molecular weight of 499.38 g/mol. Its IUPAC name is 1-ethyl-2-(4-methylsulfanylbutyl)-3-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(4-methylsulfanylbutyl)-3-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136926456 |
| Molecular Formula | C18H25F3IN3S |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 1-ethyl-2-(4-methylsulfanylbutyl)-3-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCSC)NCC#Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C18H24F3N3S.HI/c1-3-22-17(23-12-4-5-14-25-2)24-13-6-7-15-8-10-16(11-9-15)18(19,20)21;/h8-11H,3-5,12-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | REURDPJJXULUGV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|